EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO3 |
| Net Charge | 0 |
| Average Mass | 191.186 |
| Monoisotopic Mass | 191.05824 |
| SMILES | COc1cccc(C(=O)O)c1CC#N |
| InChI | InChI=1S/C10H9NO3/c1-14-9-4-2-3-8(10(12)13)7(9)5-6-11/h2-4H,5H2,1H3,(H,12,13) |
| InChIKey | GVJMTMMPLOGKCG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SureCN668028 (CHEBI:74932) has functional parent phenylacetonitrile (CHEBI:25979) |
| SureCN668028 (CHEBI:74932) has role metabolite (CHEBI:25212) |
| SureCN668028 (CHEBI:74932) is a aromatic ether (CHEBI:35618) |
| SureCN668028 (CHEBI:74932) is a methoxybenzoic acid (CHEBI:25238) |
| SureCN668028 (CHEBI:74932) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 2-(cyanomethyl)-3-methoxybenzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14502141 | Reaxys |