EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749319 - triclofos sodium
| Formula | Na.C2H3Cl3O4P |
| Net Charge | 0 |
| Average Mass | 251.365 |
| Monoisotopic Mass | 249.87322 |
| SMILES | O=P([O-])(O)OCC(Cl)(Cl)Cl.[Na+] |
| InChI | InChI=1S/C2H4Cl3O4P.Na/c3-2(4,5)1-9-10(6,7)8;/h1H2,(H2,6,7,8);/q;+1/p-1 |
| InChIKey | WFKJEZKHPGDCRK-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triclofos sodium (CHEBI:749319) is a alkyl phosphate (CHEBI:22324) |
| Synonyms | Source |
|---|---|
| SCH 10159 | ChEMBL |
| SCH-10159 | ChEMBL |
| Trichloroethyl phosphate sodium | ChEMBL |
| Triclofos monosodium salt | ChEMBL |
| Tricloryl | ChEMBL |
| Brand Name | Source |
|---|---|
| Triclos | ChEMBL |