EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N.C6H10O4 |
| Net Charge | 0 |
| Average Mass | 281.352 |
| Monoisotopic Mass | 281.16271 |
| SMILES | C[C@H](N)Cc1ccccc1.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C9H13N.C6H10O4/c1-8(10)7-9-5-3-2-4-6-9;7-5(8)3-1-2-4-6(9)10/h2-6,8H,7,10H2,1H3;1-4H2,(H,7,8)(H,9,10)/t8-;/m0./s1 |
| InChIKey | OFCJKOOVFDGTLY-QRPNPIFTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextroamphetamine adipate (CHEBI:749317) is a amphetamines (CHEBI:35338) |
| Synonym | Source |
|---|---|
| D-amphetamine adipate | ChEMBL |
| Brand Name | Source |
|---|---|
| Dextroamphetamine adipate component of delcobese | ChEMBL |