EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C24H20I6N5O8 |
| Net Charge | 0 |
| Average Mass | 1290.865 |
| Monoisotopic Mass | 1290.54779 |
| SMILES | CNC(=O)c1c(I)c(C(=O)NCC(=O)Nc2c(I)c(C(=O)[O-])c(I)c(C(=O)NCCO)c2I)c(I)c(N(C)C(C)=O)c1I.[Na+] |
| InChI | InChI=1S/C24H21I6N5O8.Na/c1-7(37)35(3)20-17(29)10(21(39)31-2)13(25)11(18(20)30)23(41)33-6-8(38)34-19-15(27)9(22(40)32-4-5-36)14(26)12(16(19)28)24(42)43;/h36H,4-6H2,1-3H3,(H,31,39)(H,32,40)(H,33,41)(H,34,38)(H,42,43);/q;+1/p-1 |
| InChIKey | MBVDCEVFLAONHO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ioxaglate sodium (CHEBI:749311) is a amidobenzoic acid (CHEBI:48470) |
| Synonym | Source |
|---|---|
| Sodium ioxaglate | ChEMBL |
| Brand Name | Source |
|---|---|
| Ioxaglate sodium component of hexabrix | ChEMBL |