EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Ca.C25H34N3O9PS |
| Net Charge | 0 |
| Average Mass | 623.678 |
| Monoisotopic Mass | 623.13793 |
| SMILES | CC(C)CN(C[C@@H](OP(=O)([O-])[O-])[C@H](Cc1ccccc1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)c1ccc(N)cc1.[Ca+2] |
| InChI | InChI=1S/C25H36N3O9PS.Ca/c1-18(2)15-28(39(33,34)22-10-8-20(26)9-11-22)16-24(37-38(30,31)32)23(14-19-6-4-3-5-7-19)27-25(29)36-21-12-13-35-17-21;/h3-11,18,21,23-24H,12-17,26H2,1-2H3,(H,27,29)(H2,30,31,32);/q;+2/p-2/t21-,23-,24+;/m0./s1 |
| InChIKey | PMDQGYMGQKTCSX-HQROKSDRSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosamprenavir calcium (CHEBI:749310) has role anti-HIV agent (CHEBI:64946) |
| fosamprenavir calcium (CHEBI:749310) is a benzenes (CHEBI:22712) |
| fosamprenavir calcium (CHEBI:749310) is a organic amino compound (CHEBI:50047) |
| Synonyms | Source |
|---|---|
| Fosamprenavir calcium salt | ChEMBL |
| GW 433908G | ChEMBL |
| GW-433908G | ChEMBL |
| Brand Name | Source |
|---|---|
| Lexiva | ChEMBL |
| Citations |
|---|