EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.CH5N3 |
| Net Charge | 0 |
| Average Mass | 95.533 |
| Monoisotopic Mass | 95.02502 |
| SMILES | Cl.N=C(N)N |
| InChI | InChI=1S/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H |
| InChIKey | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanidine hydrochloride (CHEBI:749309) has role antineoplastic agent (CHEBI:35610) |
| guanidine hydrochloride (CHEBI:749309) is a guanidines (CHEBI:24436) |
| Synonym | Source |
|---|---|
| NSC-755884 | ChEMBL |
| Citations |
|---|