EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749280 - theophylline sodium glycinate
| Formula | Na.C7H8N4O2.C2H4NO2 |
| Net Charge | 0 |
| Average Mass | 277.216 |
| Monoisotopic Mass | 277.07870 |
| SMILES | Cn1c(=O)c2ncnc2n(C)c1=O.NCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H8N4O2.C2H5NO2.Na/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2(4)5;/h3H,1-2H3,(H,8,9);1,3H2,(H,4,5);/q;;+1/p-1 |
| InChIKey | AIJQWRAOMFRHTQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| theophylline sodium glycinate (CHEBI:749280) is a oxopurine (CHEBI:25810) |
| Synonyms | Source |
|---|---|
| Bronchoparat | ChEMBL |
| Englate | ChEMBL |
| Glycin theophyllinate | ChEMBL |
| Glytheonate | ChEMBL |
| Panophylline | ChEMBL |
| Theonate sodium | ChEMBL |