EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4O2.C46H64N14O12S2 |
| Net Charge | 0 |
| Average Mass | 1129.290 |
| Monoisotopic Mass | 1128.44808 |
| SMILES | CC(=O)O.N=C(N)NCCC[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CSSCCC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N1)C(=O)NCC(N)=O |
| InChI | InChI=1S/C46H64N14O12S2.C2H4O2/c47-35(62)15-14-29-40(67)58-32(22-36(48)63)43(70)59-33(45(72)60-18-5-9-34(60)44(71)56-28(8-4-17-52-46(50)51)39(66)53-23-37(49)64)24-74-73-19-16-38(65)54-30(21-26-10-12-27(61)13-11-26)41(68)57-31(42(69)55-29)20-25-6-2-1-3-7-25;1-2(3)4/h1-3,6-7,10-13,28-34,61H,4-5,8-9,14-24H2,(H2,47,62)(H2,48,63)(H2,49,64)(H,53,66)(H,54,65)(H,55,69)(H,56,71)(H,57,68)(H,58,67)(H,59,70)(H4,50,51,52);1H3,(H,3,4)/t28-,29+,30+,31+,32+,33+,34+;/m1./s1 |
| InChIKey | MLSVJHOYXJGGTR-IFHOVBQLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desmopressin acetate (CHEBI:749275) has role antihypertensive agent (CHEBI:35674) |
| desmopressin acetate (CHEBI:749275) has role nasal decongestant (CHEBI:77715) |
| desmopressin acetate (CHEBI:749275) is a polypeptide (CHEBI:15841) |
| Synonyms | Source |
|---|---|
| Anhydrous desmopressin acetate | ChEMBL |
| Desmopressin acetate trihydrate | ChEMBL |
| Brand Names | Source |
|---|---|
| Concentraid | ChEMBL |
| Ddavp (needs no refrigeration) | ChEMBL |
| Desmomelt | ChEMBL |
| Desmopressin acetate (needs no refrigeration) | ChEMBL |
| Desmopressin acetate preservative free | ChEMBL |
| Desmospray | ChEMBL |
| Citations |
|---|