EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N3.H3O4P |
| Net Charge | 0 |
| Average Mass | 363.354 |
| Monoisotopic Mass | 363.13479 |
| SMILES | O=P(O)(O)O.c1ccc(CN(CC2=NCCN2)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19N3.H3O4P/c1-3-7-15(8-4-1)13-20(14-17-18-11-12-19-17)16-9-5-2-6-10-16;1-5(2,3)4/h1-10H,11-14H2,(H,18,19);(H3,1,2,3,4) |
| InChIKey | DUIGUKRYYAGJAF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antazoline phosphate (CHEBI:749272) is a aromatic amine (CHEBI:33860) |
| Synonym | Source |
|---|---|
| NSC-755865 | ChEMBL |
| Brand Name | Source |
|---|---|
| Antazoline phosphate component of vasocon-a | ChEMBL |
| Citations |
|---|