EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749265 - gonadorelin acetate
| Formula | C2H4O2.C55H75N17O13 |
| Net Charge | 0 |
| Average Mass | 1242.363 |
| Monoisotopic Mass | 1241.59415 |
| SMILES | CC(=O)O.CC(C)C[C@H](NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)NCC(N)=O |
| InChI | InChI=1S/C55H75N17O13.C2H4O2/c1-29(2)19-38(49(80)67-37(9-5-17-60-55(57)58)54(85)72-18-6-10-43(72)53(84)62-25-44(56)75)66-46(77)26-63-47(78)39(20-30-11-13-33(74)14-12-30)68-52(83)42(27-73)71-50(81)40(21-31-23-61-35-8-4-3-7-34(31)35)69-51(82)41(22-32-24-59-28-64-32)70-48(79)36-15-16-45(76)65-36;1-2(3)4/h3-4,7-8,11-14,23-24,28-29,36-43,61,73-74H,5-6,9-10,15-22,25-27H2,1-2H3,(H2,56,75)(H,59,64)(H,62,84)(H,63,78)(H,65,76)(H,66,77)(H,67,80)(H,68,83)(H,69,82)(H,70,79)(H,71,81)(H4,57,58,60);1H3,(H,3,4)/t36-,37-,38-,39-,40-,41-,42-,43-;/m0./s1 |
| InChIKey | NGCGMRBZPXEPOZ-HBBGHHHDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gonadorelin acetate (CHEBI:749265) has role antineoplastic agent (CHEBI:35610) |
| gonadorelin acetate (CHEBI:749265) is a polypeptide (CHEBI:15841) |
| Synonyms | Source |
|---|---|
| ABBOTT-41070 | ChEMBL |
| Gonadorelin acetate anhydrous | ChEMBL |
| Gonadorelin acetate mixture | ChEMBL |
| Gonadorelin diacetate | ChEMBL |
| Luteinizing | ChEMBL |
| Luteinizing hormone-releasing factor diacetate tetrahydrate | ChEMBL |
| Brand Names | Source |
|---|---|
| Gnrh | ChEMBL |
| Gonadotropin releasing hormone | ChEMBL |
| Lh releasing factor | ChEMBL |
| Lutrelef | ChEMBL |
| Lutrepulse kit | ChEMBL |