EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C26H25F3N6O5 |
| Net Charge | 0 |
| Average Mass | 654.624 |
| Monoisotopic Mass | 654.17197 |
| SMILES | CS(=O)(=O)O.[H][C@@]12CN(c3nc4c(cc3F)c(=O)c(C(=O)O)cn4-c3ccc(F)cc3F)C[C@]1([H])[C@H]2NC(=O)[C@H](C)NC(=O)[C@H](C)N |
| InChI | InChI=1S/C26H25F3N6O5.CH4O3S/c1-10(30)24(37)31-11(2)25(38)32-20-14-7-34(8-15(14)20)23-18(29)6-13-21(36)16(26(39)40)9-35(22(13)33-23)19-4-3-12(27)5-17(19)28;1-5(2,3)4/h3-6,9-11,14-15,20H,7-8,30H2,1-2H3,(H,31,37)(H,32,38)(H,39,40);1H3,(H,2,3,4)/t10-,11-,14-,15+,20+;/m0./s1 |
| InChIKey | CYETUYYEVKNSHZ-LGOOQLFJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alatrofloxacin mesylate (CHEBI:749261) has role antibacterial agent (CHEBI:33282) |
| alatrofloxacin mesylate (CHEBI:749261) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| 517-27 | ChEMBL |
| CP-116 | ChEMBL |
| CP-116,517 -27 | ChEMBL |
| CP-116,517-27 | ChEMBL |
| CP-116517-27 | ChEMBL |
| CP-11651727 | ChEMBL |
| Brand Names | Source |
|---|---|
| Trovan iv | ChEMBL |
| Trovan preservative free | ChEMBL |
| Turvel iv | ChEMBL |
| Citations |
|---|