EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29NO10.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 719.649 |
| Monoisotopic Mass | 719.20615 |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.[H][C@]1(O[C@H]2C[C@](O)(C(C)=O)Cc3c(O)c4c(c(O)c32)C(=O)c2c(OC)cccc2C4=O)C[C@H](N)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C27H29NO10.C6H8O7/c1-10-22(30)14(28)7-17(37-10)38-16-9-27(35,11(2)29)8-13-19(16)26(34)21-20(24(13)32)23(31)12-5-4-6-15(36-3)18(12)25(21)33;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-6,10,14,16-17,22,30,32,34-35H,7-9,28H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t10-,14-,16-,17-,22+,27-;/m0./s1 |
| InChIKey | VNTHYLVDGVBPOU-QQYBVWGSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daunorubicin citrate (CHEBI:749256) has role antineoplastic agent (CHEBI:35610) |
| daunorubicin citrate (CHEBI:749256) is a anthracycline (CHEBI:48120) |
| Synonyms | Source |
|---|---|
| Daunorubicin citrate liposome | ChEMBL |
| Daunorubicin liposomal | ChEMBL |