EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N3O3S.Na |
| Net Charge | 0 |
| Average Mass | 367.406 |
| Monoisotopic Mass | 367.09666 |
| SMILES | COc1ccc2[n-]c([S@@+]([O-])Cc3ncc(C)c(OC)c3C)nc2c1.[Na+] |
| InChI | InChI=1S/C17H18N3O3S.Na/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17;/h5-8H,9H2,1-4H3;/q-1;+1/t24-;/m0./s1 |
| InChIKey | RYXPMWYHEBGTRV-JIDHJSLPSA-N |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| esomeprazole sodium (CHEBI:749254) has role anti-ulcer drug (CHEBI:49201) |
| esomeprazole sodium (CHEBI:749254) is a benzimidazoles (CHEBI:22715) |
| esomeprazole sodium (CHEBI:749254) is a sulfoxide (CHEBI:22063) |
| Synonyms | Source |
|---|---|
| Esomeprazole (as sodium) | ChEMBL |
| H199/18 SODIUM | ChEMBL |
| Citations |
|---|