EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C9H7NO3 |
| Net Charge | 0 |
| Average Mass | 323.055 |
| Monoisotopic Mass | 322.93795 |
| SMILES | O=C([O-])CNC(=O)c1ccccc1[123I].[Na+] |
| InChI | InChI=1S/C9H8INO3.Na/c10-7-4-2-1-3-6(7)9(14)11-5-8(12)13;/h1-4H,5H2,(H,11,14)(H,12,13);/q;+1/p-1/i10-4; |
| InChIKey | XYITYKDGJLHYPW-TWDNZPFZSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodohippurate sodium i 123 (CHEBI:749246) is a N-acylglycine (CHEBI:16180) |
| Synonyms | Source |
|---|---|
| Iodohippurate i123 sodium | ChEMBL |
| Iodohippurate sodium i 123 | ChEMBL |
| Iodohippurate sodium i-123 | ChEMBL |
| Iodohippurate sodium, i-123 | ChEMBL |
| Iodohippurate sodium,i-123 | ChEMBL |
| O-iodohippurate sodium 123i-labeled form | ChEMBL |
| Brand Name | Source |
|---|---|
| Nephroflow | ChEMBL |