EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749245 - quinidine gluconate
| Formula | C20H24N2O2.C6H12O7 |
| Net Charge | 0 |
| Average Mass | 520.579 |
| Monoisotopic Mass | 520.24208 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[H][C@]1(C=C)CN2CC[C@H]1C[C@]2([H])[C@@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H24N2O2.C6H12O7/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;7-1-2(8)3(9)4(10)5(11)6(12)13/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2-5,7-11H,1H2,(H,12,13)/t13-,14-,19+,20-;2-,3-,4+,5-/m01/s1 |
| InChIKey | XHKUDCCTVQUHJQ-LCYSNFERSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinidine gluconate (CHEBI:749245) has role anti-arrhythmia drug (CHEBI:38070) |
| quinidine gluconate (CHEBI:749245) has role antimalarial (CHEBI:38068) |
| quinidine gluconate (CHEBI:749245) is a cinchona alkaloid (CHEBI:51323) |
| Synonyms | Source |
|---|---|
| Dura-tab | ChEMBL |
| Gluconic acid quinidine salt | ChEMBL |
| Gluquinate | ChEMBL |
| NSC-757297 | ChEMBL |
| Quinidine mono-d-gluconate | ChEMBL |
| Quinidine monogluconate, d- | ChEMBL |
| Brand Names | Source |
|---|---|
| Duraquin | ChEMBL |
| Quinact | ChEMBL |
| Quinaglute | ChEMBL |
| Quinalan | ChEMBL |
| Quinatime | ChEMBL |
| Citations |
|---|