EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C12H17NO4 |
| Net Charge | 0 |
| Average Mass | 275.732 |
| Monoisotopic Mass | 275.09244 |
| SMILES | CCOC(=O)[C@@](C)(N)Cc1ccc(O)c(O)c1.Cl |
| InChI | InChI=1S/C12H17NO4.ClH/c1-3-17-11(16)12(2,13)7-8-4-5-9(14)10(15)6-8;/h4-6,14-15H,3,7,13H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | QSRVZCCJDKYRRF-YDALLXLXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyldopate hydrochloride (CHEBI:749243) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| Methyldopa l-form ethyl ester hydrochloride | ChEMBL |
| Methyldopate hydrochloride | ChEMBL |
| NSC-760088 | ChEMBL |