EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C11H13N |
| Net Charge | 0 |
| Average Mass | 195.693 |
| Monoisotopic Mass | 195.08148 |
| SMILES | C#CCN(C)Cc1ccccc1.Cl |
| InChI | InChI=1S/C11H13N.ClH/c1-3-9-12(2)10-11-7-5-4-6-8-11;/h1,4-8H,9-10H2,2H3;1H |
| InChIKey | BCXCABRDBBWWGY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pargyline hydrochloride (CHEBI:749242) is a aromatic amine (CHEBI:33860) |
| Synonyms | Source |
|---|---|
| A-19120 | ChEMBL |
| MO-911 | ChEMBL |
| NSC-43798 | ChEMBL |
| Brand Name | Source |
|---|---|
| Pargyline hydrochloride component of eutron | ChEMBL |
| Citations |
|---|