EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749237 - azathioprine sodium
| Formula | Na.C9H6N7O2S |
| Net Charge | 0 |
| Average Mass | 299.251 |
| Monoisotopic Mass | 299.02014 |
| SMILES | Cn1cnc([N+](=O)[O-])c1Sc1ncnc2nc[n-]c12.[Na+] |
| InChI | InChI=1S/C9H6N7O2S.Na/c1-15-4-14-7(16(17)18)9(15)19-8-5-6(11-2-10-5)12-3-13-8;/h2-4H,1H3;/q-1;+1 |
| InChIKey | WISNYKIQFMKSDQ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azathioprine sodium (CHEBI:749237) is a aryl sulfide (CHEBI:35683) |
| Synonym | Source |
|---|---|
| Azathioprine sodium salt | ChEMBL |
| Brand Name | Source |
|---|---|
| Imuran injection | ChEMBL |