EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C8H7O2 |
| Net Charge | 0 |
| Average Mass | 158.132 |
| Monoisotopic Mass | 158.03437 |
| SMILES | O=C([O-])Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C8H8O2.Na/c9-8(10)6-7-4-2-1-3-5-7;/h1-5H,6H2,(H,9,10);/q;+1/p-1 |
| InChIKey | HZOREEUASZHZBI-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium phenylacetate (CHEBI:749228) has role antineoplastic agent (CHEBI:35610) |
| sodium phenylacetate (CHEBI:749228) is a benzenes (CHEBI:22712) |
| Synonyms | Source |
|---|---|
| NSC-3039 | ChEMBL |
| Sodium phenylacetic acid | ChEMBL |
| Brand Names | Source |
|---|---|
| Sodium phenylacetate component of ammonul | ChEMBL |
| Sodium phenylacetate component of ucephan | ChEMBL |