EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C4H5O4 |
| Net Charge | 0 |
| Average Mass | 140.070 |
| Monoisotopic Mass | 140.00855 |
| SMILES | O=C([O-])CCC(=O)O.[Na+] |
| InChI | InChI=1S/C4H6O4.Na/c5-3(6)1-2-4(7)8;/h1-2H2,(H,5,6)(H,7,8);/q;+1/p-1 |
| InChIKey | KZQSXALQTHVPDQ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium succinate (CHEBI:749223) is a dicarboxylic acid (CHEBI:35692) |
| Synonyms | Source |
|---|---|
| Butanedioic acid disodium salt | ChEMBL |
| FEMA NO. 3277 | ChEMBL |
| Sodium succinate | ChEMBL |
| Sodium succinate anhydrous | ChEMBL |
| Sodium succinate, anhydrous | ChEMBL |
| Sodium succinate hexahydrate | ChEMBL |