EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:74922 - 1-acyl-2-arachidonoyl-sn-glycero-3-phosphate(2−)
| Formula | C24H36O8PR |
| Net Charge | -2 |
| Average Mass (excl. R groups) | 483.513 |
| Monoisotopic Mass (excl. R groups) | 483.21478 |
| SMILES | *C(=O)OC[C@H](COP(=O)([O-])[O-])OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-acyl-2-arachidonoyl-sn-glycero-3-phosphate(2−) (CHEBI:74922) is a 1,2-diacyl-sn-glycerol 3-phosphate(2−) (CHEBI:58608) |
| 1-acyl-2-arachidonoyl-sn-glycero-3-phosphate(2−) (CHEBI:74922) is conjugate base of 1-acyl-2-arachidonoyl-sn-glycero-3-phosphate (CHEBI:75112) |
| Incoming Relation(s) |
| 1-icosanoyl-2-arachidonoyl-sn-glycero-3-phosphate(2−) (CHEBI:77094) is a 1-acyl-2-arachidonoyl-sn-glycero-3-phosphate(2−) (CHEBI:74922) |
| 1-oleoyl-2-arachidonoyl-sn-glycero-3-phosphate(2−) (CHEBI:74928) is a 1-acyl-2-arachidonoyl-sn-glycero-3-phosphate(2−) (CHEBI:74922) |
| 1-stearoyl-2-arachidonoyl-sn-glycero-3-phosphate(2−) (CHEBI:77091) is a 1-acyl-2-arachidonoyl-sn-glycero-3-phosphate(2−) (CHEBI:74922) |
| 1,2-diarachidonoyl-sn-glycero-3-phosphate(2−) (CHEBI:77126) is a 1-acyl-2-arachidonoyl-sn-glycero-3-phosphate(2−) (CHEBI:74922) |
| 1-acyl-2-arachidonoyl-sn-glycero-3-phosphate (CHEBI:75112) is conjugate acid of 1-acyl-2-arachidonoyl-sn-glycero-3-phosphate(2−) (CHEBI:74922) |
| Synonyms | Source |
|---|---|
| 1-acyl-2-(5Z,8Z,11Z,14Z)-eicosatetraenoyl-sn-glycero-3-phosphate(2−) | SUBMITTER |
| 1-acyl-2-(5Z,8Z,11Z,14Z)-icosatetraenoyl-sn-glycero-3-phosphate(2−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| a 1-acyl-2-(5Z,8Z,11Z,14Z)-eicosatetraenoyl-sn-glycero-3-phosphate | UniProt |