EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749219 - ronacaleret
| Formula | C25H31F2NO4 |
| Net Charge | 0 |
| Average Mass | 447.522 |
| Monoisotopic Mass | 447.22211 |
| SMILES | CC(C)(CC1Cc2ccccc2C1)NC[C@@H](O)COc1cc(CCC(=O)O)cc(F)c1F |
| InChI | InChI=1S/C25H31F2NO4/c1-25(2,13-17-9-18-5-3-4-6-19(18)10-17)28-14-20(29)15-32-22-12-16(7-8-23(30)31)11-21(26)24(22)27/h3-6,11-12,17,20,28-29H,7-10,13-15H2,1-2H3,(H,30,31)/t20-/m1/s1 |
| InChIKey | FQJISUPNMFRIFZ-HXUWFJFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ronacaleret (CHEBI:749219) has role bone density conservation agent (CHEBI:50646) |
| ronacaleret (CHEBI:749219) is a benzenes (CHEBI:22712) |
| ronacaleret (CHEBI:749219) is a monocarboxylic acid (CHEBI:25384) |
| INN | Source |
|---|---|
| ronacaleret | WHO MedNet |
| Synonym | Source |
|---|---|
| Sb-751689 | ChEMBL |
| Citations |
|---|