EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H52N4O6 |
| Net Charge | 0 |
| Average Mass | 672.867 |
| Monoisotopic Mass | 672.38869 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)N[C@@H](Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C39H52N4O6/c1-26(2)21-33(37(47)41-32(35(40)45)24-29-19-13-8-14-20-29)42-36(46)30(22-27-15-9-6-10-16-27)25-34(44)31(23-28-17-11-7-12-18-28)43-38(48)49-39(3,4)5/h6-20,26,30-34,44H,21-25H2,1-5H3,(H2,40,45)(H,41,47)(H,42,46)(H,43,48)/t30-,31+,32+,33+,34-/m1/s1 |
| InChIKey | MURCDOXDAHPNRQ-ZJKZPDEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | peptidomimetic A small protein-like chain designed to mimic a peptide. EC 3.4.23.46 (memapsin 2) inhibitor An EC 3.4.23.* (aspartic endopeptidase) inhibitor that interferes with the activity of memapsin 2 (EC 3.4.23.46). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-685,458 (CHEBI:74921) has part tert-butoxycarbonyl group (CHEBI:48502) |
| L-685,458 (CHEBI:74921) has role EC 3.4.23.46 (memapsin 2) inhibitor (CHEBI:74925) |
| L-685,458 (CHEBI:74921) has role peptidomimetic (CHEBI:63175) |
| L-685,458 (CHEBI:74921) is a carbamate ester (CHEBI:23003) |
| L-685,458 (CHEBI:74921) is a monocarboxylic acid amide (CHEBI:29347) |
| L-685,458 (CHEBI:74921) is a peptide (CHEBI:16670) |
| L-685,458 (CHEBI:74921) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| GCB (CHEBI:74858) has functional parent L-685,458 (CHEBI:74921) |
| IUPAC Name |
|---|
| N-{(2R,4R,5S)-2-benzyl-5-[(tert-butoxycarbonyl)amino]-4-hydroxy-6-phenylhexanoyl}-L-leucyl-L-phenylalaninamide |
| Synonyms | Source |
|---|---|
| (1S,2R,4R)-{1-benzyl-4-[1-(1S)-carbamoyl-(2-phenylethylcarbamoyl)-(1S)-3-methylbutylcarbamoyl]-2-hydroxy-5-phenylpentyl}carbamic acid tert-butyl ester | ChEBI |
| {(1S)-benzyl-(4R)-[1-((1S)-carbamoyl-2-phenyl-ethylcarbamoyl)-(1S)-3-methyl-butyl-carbamoyl]-(2R)-hydroxy-5-phenyl-pentyl} carbamic acid tert-butyl ester | ChEBI |
| {1(S)-benzyl-4(R)-[1-(1(S)-carbamoyl-2-phenylethylcarbamoyl)-1(S)-3-methyl-butylcarbamoyl]-2(R)-hydroxy-5-phenylpentyl}carbamic acid tert-butyl ester | ChEBI |
| (5S)-[tert-butoxycarbonylamino-6-phenyl-(4R)-hydroxy-(2R)-benzylhexanoyl]-L-Leu-L-Phe-NH2 | ChEBI |
| L-685458 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8816919 | Reaxys |
| Citations |
|---|