EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N2O2 |
| Net Charge | 0 |
| Average Mass | 414.549 |
| Monoisotopic Mass | 414.23073 |
| SMILES | CN(C(=O)C(c1ccccc1)c1ccccc1)[C@H](CN1CC[C@H](O)C1)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O2/c1-28(25(21-11-5-2-6-12-21)20-29-18-17-24(30)19-29)27(31)26(22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,24-26,30H,17-20H2,1H3/t24-,25+/m0/s1 |
| InChIKey | JHLHNYVMZCADTC-LOSJGSFVSA-N |
| Roles Classification |
|---|
| Applications: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asimadoline (CHEBI:749204) has role antispasmodic drug (CHEBI:53784) |
| asimadoline (CHEBI:749204) has role gastrointestinal drug (CHEBI:55324) |
| asimadoline (CHEBI:749204) is a diarylmethane (CHEBI:51614) |
| INNs | Source |
|---|---|
| asimadolina | WHO MedNet |
| asimadoline | WHO MedNet |
| Synonym | Source |
|---|---|
| EMD-61753 | ChEMBL |
| Citations |
|---|