EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17NO7 |
| Net Charge | 0 |
| Average Mass | 371.345 |
| Monoisotopic Mass | 371.10050 |
| SMILES | CCCc1c2oc(C(=O)O)cc(=O)c2cc2c(=O)cc(C(=O)O)n(CC)c12 |
| InChI | InChI=1S/C19H17NO7/c1-3-5-9-16-10(13(21)7-12(18(23)24)20(16)4-2)6-11-14(22)8-15(19(25)26)27-17(9)11/h6-8H,3-5H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | RQTOOFIXOKYGAN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | anti-asthmatic drug A drug used to treat asthma. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nedocromil (CHEBI:7492) has role anti-allergic agent (CHEBI:50857) |
| nedocromil (CHEBI:7492) has role anti-asthmatic drug (CHEBI:49167) |
| nedocromil (CHEBI:7492) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| nedocromil (CHEBI:7492) is a dicarboxylic acid (CHEBI:35692) |
| nedocromil (CHEBI:7492) is a organic heterotricyclic compound (CHEBI:26979) |
| nedocromil (CHEBI:7492) is conjugate acid of nedocromil(2−) (CHEBI:51029) |
| Incoming Relation(s) |
| nedocromil(2−) (CHEBI:51029) is conjugate base of nedocromil (CHEBI:7492) |
| IUPAC Name |
|---|
| 9-ethyl-4,6-dioxo-10-propyl-6,9-dihydro-4H-pyrano[3,2-g]quinoline-2,8-dicarboxylic acid |
| INNs | Source |
|---|---|
| nedocromil | ChEBI |
| nédocromil | ChEBI |
| nedocromilo | ChEBI |
| nedocromilum | ChEBI |
| Synonyms | Source |
|---|---|
| 9-Ethyl-6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano(3,2-g)chinolin-2,8-dicarbonsäure | ChemIDplus |
| 9-ethyl-6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano(3,2-g)quinoline-2,8-dicarboxylic acid | ChemIDplus |
| Nedocromil | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:588536 | Beilstein |
| CAS:69049-73-6 | ChemIDplus |