EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33ClN4O2S |
| Net Charge | 0 |
| Average Mass | 489.085 |
| Monoisotopic Mass | 488.20127 |
| SMILES | NCCCC(=O)OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C25H33ClN4O2S/c26-20-8-9-24-22(19-20)30(21-5-1-2-6-23(21)33-24)12-4-11-28-13-15-29(16-14-28)17-18-32-25(31)7-3-10-27/h1-2,5-6,8-9,19H,3-4,7,10-18,27H2 |
| InChIKey | BABFYCSPNDKXRI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perphenazine 4-aminobutyrate (CHEBI:749197) has role antipsychotic agent (CHEBI:35476) |
| perphenazine 4-aminobutyrate (CHEBI:749197) is a phenothiazines (CHEBI:38093) |
| Synonyms | Source |
|---|---|
| Bl-1020 | ChEMBL |
| Perphenazine 4-aminobutyrate | ChEMBL |