EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749191 - nitroblue tetrazolium
| Formula | C40H30N10O6 |
| Net Charge | +2 |
| Average Mass | 746.744 |
| Monoisotopic Mass | 746.23388 |
| SMILES | COc1cc(-c2ccc(-n3nc(-c4ccccc4)n[n+]3-c3ccc([N+](=O)[O-])cc3)c(OC)c2)ccc1-n1nc(-c2ccccc2)n[n+]1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C40H30N10O6/c1-55-37-25-29(13-23-35(37)47-43-39(27-9-5-3-6-10-27)41-45(47)31-15-19-33(20-16-31)49(51)52)30-14-24-36(38(26-30)56-2)48-44-40(28-11-7-4-8-12-28)42-46(48)32-17-21-34(22-18-32)50(53)54/h3-26H,1-2H3/q+2 |
| InChIKey | JPXMTWWFLBLUCD-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitroblue tetrazolium (CHEBI:749191) is a C-nitro compound (CHEBI:35716) |
| Synonyms | Source |
|---|---|
| Nitroblue tetrazolium cation | ChEMBL |
| Nitroblue tetrazolium ion | ChEMBL |