EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H22N4O2S2 |
| Net Charge | 0 |
| Average Mass | 294.446 |
| Monoisotopic Mass | 294.11842 |
| SMILES | NCCC(=O)NCCSSCCNC(=O)CCN |
| InChI | InChI=1S/C10H22N4O2S2/c11-3-1-9(15)13-5-7-17-18-8-6-14-10(16)2-4-12/h1-8,11-12H2,(H,13,15)(H,14,16) |
| InChIKey | WELIVEBWRWAGOM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alethine (CHEBI:749189) has functional parent β-amino acid (CHEBI:33706) |
| alethine (CHEBI:749189) has role antineoplastic agent (CHEBI:35610) |
| alethine (CHEBI:749189) is a organonitrogen compound (CHEBI:35352) |
| alethine (CHEBI:749189) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| Alethine | ChEMBL |
| Alethine, beta- | ChEMBL |
| .beta.-alethine | ChEMBL |
| Beta alethine | ChEMBL |
| Beta-alethine | ChEMBL |
| Betathine | ChEMBL |