EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O3S |
| Net Charge | 0 |
| Average Mass | 243.288 |
| Monoisotopic Mass | 243.06776 |
| SMILES | Nc1ccn([C@H]2C[C@H](O)[C@@H](CO)S2)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O3S/c10-7-1-2-12(9(15)11-7)8-3-5(14)6(4-13)16-8/h1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15)/t5-,6+,8+/m0/s1 |
| InChIKey | MOMUJZRKXYLWMH-SHYZEUOFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-thio-2'-deoxycytidine (CHEBI:749173) has role antineoplastic agent (CHEBI:35610) |
| 4'-thio-2'-deoxycytidine (CHEBI:749173) is a nucleoside analogue (CHEBI:60783) |
| Synonyms | Source |
|---|---|
| 2'-deoxy-4'-thiocytidine | ChEMBL |
| 4'-thio-2'-deoxycytidine | ChEMBL |
| 4'-thio-2'-deoxycytidine, (-)- | ChEMBL |
| NSC-764276 | ChEMBL |
| Tdcyd | ChEMBL |
| Citations |
|---|