EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18ClNO2 |
| Net Charge | 0 |
| Average Mass | 255.745 |
| Monoisotopic Mass | 255.10261 |
| SMILES | C[C@@H]1NC(C)(C)CO[C@@]1(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO2/c1-9-13(16,17-8-12(2,3)15-9)10-5-4-6-11(14)7-10/h4-7,9,15-16H,8H2,1-3H3/t9-,13+/m0/s1 |
| InChIKey | RCOBKSKAZMVBHT-TVQRCGJNSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| radafaxine (CHEBI:749172) has role antidepressant (CHEBI:35469) |
| radafaxine (CHEBI:749172) is a morpholines (CHEBI:38785) |
| INNs | Source |
|---|---|
| radafaxina | WHO MedNet |
| radafaxine | WHO MedNet |
| Citations |
|---|