EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17Cl2NO |
| Net Charge | 0 |
| Average Mass | 286.202 |
| Monoisotopic Mass | 285.06872 |
| SMILES | COC[C@@]12CNCC[C@]1(c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C14H17Cl2NO/c1-18-9-13-7-14(13,4-5-17-8-13)10-2-3-11(15)12(16)6-10/h2-3,6,17H,4-5,7-9H2,1H3/t13-,14-/m1/s1 |
| InChIKey | ICXJGCSEMJXNQF-ZIAGYGMSSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk1360707 (CHEBI:749171) has role antidepressant (CHEBI:35469) |
| gsk1360707 (CHEBI:749171) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| 1-(3,4-dichlorophenyl)-6-(methoxymethyl)-3-azabicyclo[4.1.0]heptane (enantiomeric mix) | ChEMBL |
| Gsk1360707 | ChEMBL |
| Citations |
|---|