EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20F7N3O4S |
| Net Charge | 0 |
| Average Mass | 543.461 |
| Monoisotopic Mass | 543.10627 |
| SMILES | C[C@H](Oc1ccc(S(C)(=O)=O)cc1C(=O)N1CCN(c2ncc(C(F)(F)F)cc2F)CC1)C(F)(F)F |
| InChI | InChI=1S/C21H20F7N3O4S/c1-12(20(23,24)25)35-17-4-3-14(36(2,33)34)10-15(17)19(32)31-7-5-30(6-8-31)18-16(22)9-13(11-29-18)21(26,27)28/h3-4,9-12H,5-8H2,1-2H3/t12-/m0/s1 |
| InChIKey | YUUGYIUSCYNSQR-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bitopertin (CHEBI:749170) has role anti-anaemic agent (CHEBI:75835) |
| bitopertin (CHEBI:749170) has role antipsychotic agent (CHEBI:35476) |
| bitopertin (CHEBI:749170) is a piperazines (CHEBI:26144) |
| bitopertin (CHEBI:749170) is a pyridines (CHEBI:26421) |
| INNs | Source |
|---|---|
| bitopertin | WHO MedNet |
| bitopertina | WHO MedNet |
| bitopertine | WHO MedNet |
| Synonyms | Source |
|---|---|
| DISC-1459 | ChEMBL |
| Paliflutine | ChEMBL |
| R-1678 | ChEMBL |
| RG-1678 | ChEMBL |
| RO-4917838 | ChEMBL |
| RO4917838 | ChEMBL |
| Citations |
|---|