EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20F7N3O4S |
| Net Charge | 0 |
| Average Mass | 543.461 |
| Monoisotopic Mass | 543.10627 |
| SMILES | C[C@H](Oc1ccc(S(C)(=O)=O)cc1C(=O)N1CCN(c2ncc(C(F)(F)F)cc2F)CC1)C(F)(F)F |
| InChI | InChI=1S/C21H20F7N3O4S/c1-12(20(23,24)25)35-17-4-3-14(36(2,33)34)10-15(17)19(32)31-7-5-30(6-8-31)18-16(22)9-13(11-29-18)21(26,27)28/h3-4,9-12H,5-8H2,1-2H3/t12-/m0/s1 |
| InChIKey | YUUGYIUSCYNSQR-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bitopertin (CHEBI:749170) has role anti-anaemic agent (CHEBI:75835) |
| bitopertin (CHEBI:749170) has role antipsychotic agent (CHEBI:35476) |
| bitopertin (CHEBI:749170) is a piperazines (CHEBI:26144) |
| bitopertin (CHEBI:749170) is a pyridines (CHEBI:26421) |
| INNs | Source |
|---|---|
| bitopertin | WHO MedNet |
| bitopertina | WHO MedNet |
| bitopertine | WHO MedNet |
| Synonyms | Source |
|---|---|
| DISC-1459 | ChEMBL |
| Paliflutine | ChEMBL |
| R-1678 | ChEMBL |
| RG-1678 | ChEMBL |
| RO-4917838 | ChEMBL |
| RO4917838 | ChEMBL |
| Citations |
|---|