EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25FN4O2 |
| Net Charge | 0 |
| Average Mass | 324.400 |
| Monoisotopic Mass | 324.19615 |
| SMILES | CC(C)(CC(=O)N1CCCC1)NCC(=O)N1C[C@@H](F)C[C@H]1C#N |
| InChI | InChI=1S/C16H25FN4O2/c1-16(2,8-14(22)20-5-3-4-6-20)19-10-15(23)21-11-12(17)7-13(21)9-18/h12-13,19H,3-8,10-11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | VQKSCYBKUIDZEI-STQMWFEESA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dbpr-108 (CHEBI:749157) has role hypoglycemic agent (CHEBI:35526) |
| dbpr-108 (CHEBI:749157) has role renoprotective agent (CHEBI:231911) |
| dbpr-108 (CHEBI:749157) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| prusogliptin | WHO MedNet |
| Synonym | Source |
|---|---|
| DBPR-108 | ChEMBL |
| Citations |
|---|