EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19FN2O3S |
| Net Charge | 0 |
| Average Mass | 362.426 |
| Monoisotopic Mass | 362.11004 |
| SMILES | NC(=O)NC[C@@H]1CCCc2cc(S(=O)(=O)c3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C18H19FN2O3S/c19-14-5-2-6-15(10-14)25(23,24)16-7-8-17-12(9-16)3-1-4-13(17)11-21-18(20)22/h2,5-10,13H,1,3-4,11H2,(H3,20,21,22)/t13-/m0/s1 |
| InChIKey | MTTHRRVVGMPYQG-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| landipirdine (CHEBI:749155) has role antiparkinson drug (CHEBI:48407) |
| landipirdine (CHEBI:749155) is a tetralins (CHEBI:36786) |
| INNs | Source |
|---|---|
| landipirdina | WHO MedNet |
| landipirdine | WHO MedNet |
| Synonyms | Source |
|---|---|
| R0-5025181 | ChEMBL |
| R05025181 | ChEMBL |
| R0-5025181-000 | ChEMBL |
| R05025181-000 | ChEMBL |
| RO5025181 | ChEMBL |
| RO5025181-000 | ChEMBL |
| Citations |
|---|