EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32N2O4 |
| Net Charge | 0 |
| Average Mass | 436.552 |
| Monoisotopic Mass | 436.23621 |
| SMILES | CC(C)(CC1Cc2ccccc2C1)NC[C@@H](O)COc1cc(CCC(=O)O)ccc1C#N |
| InChI | InChI=1S/C26H32N2O4/c1-26(2,14-19-11-20-5-3-4-6-21(20)12-19)28-16-23(29)17-32-24-13-18(8-10-25(30)31)7-9-22(24)15-27/h3-7,9,13,19,23,28-29H,8,10-12,14,16-17H2,1-2H3,(H,30,31)/t23-/m1/s1 |
| InChIKey | NJBFJCJKWWIKRD-HSZRJFAPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sb-423562 (CHEBI:749153) is a benzenes (CHEBI:22712) |
| sb-423562 (CHEBI:749153) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| Npsp795 | ChEMBL |
| NPSP-795 | ChEMBL |
| Sb-423562 | ChEMBL |
| SB-423562-A | ChEMBL |
| SHP-635 | ChEMBL |
| Citations |
|---|