EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O4S.C16H16ClNO2S |
| Net Charge | 0 |
| Average Mass | 419.908 |
| Monoisotopic Mass | 419.02641 |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCc2sccc2C1.O=S(=O)(O)O |
| InChI | InChI=1S/C16H16ClNO2S.H2O4S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;1-5(2,3)4/h2-5,7,9,15H,6,8,10H2,1H3;(H2,1,2,3,4)/t15-;/m0./s1 |
| InChIKey | FDEODCTUSIWGLK-RSAXXLAASA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clopidogrel bisulfate (CHEBI:749151) has role anti-arrhythmia drug (CHEBI:38070) |
| clopidogrel bisulfate (CHEBI:749151) has role antineoplastic agent (CHEBI:35610) |
| clopidogrel bisulfate (CHEBI:749151) has role cardiovascular drug (CHEBI:35554) |
| clopidogrel bisulfate (CHEBI:749151) is a α-amino acid ester (CHEBI:46874) |
| Synonyms | Source |
|---|---|
| Clopidogrel (as bisulfate) | ChEMBL |
| Clopidogrel (as hydrogen sulfate) | ChEMBL |
| Clopidogrel-bgr | ChEMBL |
| Clopidogrel bisulphate | ChEMBL |
| Clopidogrel bms | ChEMBL |
| Clopidogrel-bms | ChEMBL |
| Brand Names | Source |
|---|---|
| Clopidogrel bgr (previously zylagren) | ChEMBL |
| Clopidogrel bisulfate component of clopidogrel/acetylsalicyclic acid teva | ChEMBL |
| Clopidogrel bisulfate component of duocover | ChEMBL |
| Clopidogrel bisulfate component of duoplavin | ChEMBL |
| Clopidogrel ratiopharm | ChEMBL |
| Clopidogrel teva (hydrogen sulphate) | ChEMBL |
| Citations |
|---|