EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749149 - cipargamin
| Formula | C19H14Cl2FN3O |
| Net Charge | 0 |
| Average Mass | 390.245 |
| Monoisotopic Mass | 389.04980 |
| SMILES | C[C@H]1Cc2c(nc3cc(Cl)c(F)cc23)[C@@]2(N1)C(=O)Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C19H14Cl2FN3O/c1-8-4-11-10-6-14(22)13(21)7-16(10)23-17(11)19(25-8)12-5-9(20)2-3-15(12)24-18(19)26/h2-3,5-8,23,25H,4H2,1H3,(H,24,26)/t8-,19+/m0/s1 |
| InChIKey | CKLPLPZSUQEDRT-WPCRTTGESA-N |
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cipargamin (CHEBI:749149) has role antimalarial (CHEBI:38068) |
| cipargamin (CHEBI:749149) is a harmala alkaloid (CHEBI:61379) |
| INNs | Source |
|---|---|
| cipargamin | WHO MedNet |
| cipargamina | WHO MedNet |
| cipargamine | WHO MedNet |
| Synonyms | Source |
|---|---|
| KAE-609 | ChEMBL |
| KAE609 | ChEMBL |
| NITD-609 | ChEMBL |
| NITD-609, (+)- | ChEMBL |
| NITD609 | ChEMBL |
| Citations |
|---|