EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26ClN3O5S |
| Net Charge | 0 |
| Average Mass | 479.986 |
| Monoisotopic Mass | 479.12817 |
| SMILES | O=C([C@H](O)CS(=O)(=O)c1ccc2cc(Cl)ccc2c1)N1CCC(N2CCCNC2=O)CC1 |
| InChI | InChI=1S/C22H26ClN3O5S/c23-17-4-2-16-13-19(5-3-15(16)12-17)32(30,31)14-20(27)21(28)25-10-6-18(7-11-25)26-9-1-8-24-22(26)29/h2-5,12-13,18,20,27H,1,6-11,14H2,(H,24,29)/t20-/m1/s1 |
| InChIKey | GEHAEMCVKDPMKO-HXUWFJFHSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| letaxaban (CHEBI:749148) has role cardiovascular drug (CHEBI:35554) |
| letaxaban (CHEBI:749148) is a naphthalenes (CHEBI:25477) |
| letaxaban (CHEBI:749148) is a sulfonic acid derivative (CHEBI:33552) |
| INN | Source |
|---|---|
| letaxaban | WHO MedNet |
| Synonyms | Source |
|---|---|
| TAK 442 | ChEMBL |
| TAK-442 | ChEMBL |
| TAK442 | ChEMBL |
| Citations |
|---|