EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O4 |
| Net Charge | 0 |
| Average Mass | 368.433 |
| Monoisotopic Mass | 368.17361 |
| SMILES | COc1ccc(C[C@@H](C)NC[C@H](O)c2ccc(O)c3nc(=O)ccc23)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-13(11-14-3-5-15(27-2)6-4-14)22-12-19(25)16-7-9-18(24)21-17(16)8-10-20(26)23-21/h3-10,13,19,22,24-25H,11-12H2,1-2H3,(H,23,26)/t13-,19+/m1/s1 |
| InChIKey | IHOXNOQMRZISPV-YJYMSZOUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carmoterol (CHEBI:749145) is a amphetamines (CHEBI:35338) |
| INN | Source |
|---|---|
| carmoterol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Chf 4226 | ChEMBL |
| CHF-4226 | ChEMBL |
| Quinoterol | ChEMBL |
| TA-2005 | ChEMBL |
| Citations |
|---|