EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H51NO15 |
| Net Charge | 0 |
| Average Mass | 869.917 |
| Monoisotopic Mass | 869.32587 |
| SMILES | [H][C@]12[C@H](OC(=O)c3ccccc3)[C@]3(O)C[C@H](OC(=O)[C@H](O)[C@@H](NC(=O)c4ccccc4)c4ccccc4)C(C)=C([C@@H](OC(C)=O)C(=O)[C@]1(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)OC)C3(C)C |
| InChI | InChI=1S/C47H51NO15/c1-25-30(61-42(55)35(51)34(27-16-10-7-11-17-27)48-40(53)28-18-12-8-13-19-28)23-47(57)39(62-41(54)29-20-14-9-15-21-29)37-45(5,38(52)36(60-26(2)49)33(25)44(47,3)4)31(50)22-32-46(37,24-59-32)63-43(56)58-6/h7-21,30-32,34-37,39,50-51,57H,22-24H2,1-6H3,(H,48,53)/t30-,31-,32+,34-,35+,36+,37-,39-,45+,46-,47+/m0/s1 |
| InChIKey | GMJWGJSDPOAZTP-MIDYMNAOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-188797 (CHEBI:749144) has role antineoplastic agent (CHEBI:35610) |
| bms-188797 (CHEBI:749144) is a taxane diterpenoid (CHEBI:50367) |
| Synonyms | Source |
|---|---|
| 4-desacetylpaclitaxel 4-methyl carbonate | ChEMBL |
| Bms-188797 | ChEMBL |
| Citations |
|---|