EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749140 - iothalamate sodium
| Formula | Na.C11H8I3N2O4 |
| Net Charge | 0 |
| Average Mass | 635.897 |
| Monoisotopic Mass | 635.75160 |
| SMILES | CNC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)[O-])c1I.[Na+] |
| InChI | InChI=1S/C11H9I3N2O4.Na/c1-3(17)16-9-7(13)4(10(18)15-2)6(12)5(8(9)14)11(19)20;/h1-2H3,(H,15,18)(H,16,17)(H,19,20);/q;+1/p-1 |
| InChIKey | WCIMWHNSWLLELS-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iothalamate sodium (CHEBI:749140) is a amidobenzoic acid (CHEBI:48470) |
| Synonyms | Source |
|---|---|
| Iotalamate sodium | ChEMBL |
| Iothalamic acid sodium salt | ChEMBL |
| Sodium iotalamate | ChEMBL |
| Brand Names | Source |
|---|---|
| Angio-conray | ChEMBL |
| Conray 325 | ChEMBL |
| Conray 400 | ChEMBL |
| Iothalamate sodium component of vascoray | ChEMBL |
| Citations |
|---|