EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36F2N2O2 |
| Net Charge | 0 |
| Average Mass | 470.604 |
| Monoisotopic Mass | 470.27448 |
| SMILES | C[C@@H]1CN(C(=O)[C@@H]2CN(C(C)(C)C)C[C@H]2c2ccc(F)cc2F)C[C@H](C)[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C28H36F2N2O2/c1-18-14-31(15-19(2)28(18,34)20-9-7-6-8-10-20)26(33)24-17-32(27(3,4)5)16-23(24)22-12-11-21(29)13-25(22)30/h6-13,18-19,23-24,34H,14-17H2,1-5H3/t18-,19+,23-,24+,28-/m0/s1 |
| InChIKey | WHPJOAUPIZDJNX-AGGGUQDCSA-N |
| Roles Classification |
|---|
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-00446687 (CHEBI:749138) has role vasodilator agent (CHEBI:35620) |
| pf-00446687 (CHEBI:749138) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| Pf-00446687 | ChEMBL |
| (-)-PF-00446687 | ChEMBL |