EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23FN2O5S |
| Net Charge | 0 |
| Average Mass | 446.500 |
| Monoisotopic Mass | 446.13117 |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(CCO)S(C)(=O)=O)c(C3CC3)cc12 |
| InChI | InChI=1S/C22H23FN2O5S/c1-24-22(27)20-17-11-16(13-3-4-13)18(25(9-10-26)31(2,28)29)12-19(17)30-21(20)14-5-7-15(23)8-6-14/h5-8,11-13,26H,3-4,9-10H2,1-2H3,(H,24,27) |
| InChIKey | WTDWVLJJJOTABN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nesbuvir (CHEBI:749135) has role antiviral agent (CHEBI:22587) |
| nesbuvir (CHEBI:749135) is a benzofurans (CHEBI:35259) |
| INN | Source |
|---|---|
| nesbuvir | WHO MedNet |
| Synonyms | Source |
|---|---|
| Hcv 796 | ChEMBL |
| HCV-796 | ChEMBL |
| HCV796 | ChEMBL |
| Citations |
|---|