EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N7O13PS |
| Net Charge | 0 |
| Average Mass | 703.624 |
| Monoisotopic Mass | 703.16729 |
| SMILES | CO[C@@H]1[C@H](OP(=O)(OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C[C@@H]2O)SCOC(=O)OC(C)C)[C@@H](CO)O[C@H]1n1ccc(=O)nc1=O |
| InChI | InChI=1S/C25H34N7O13PS/c1-12(2)42-25(37)40-11-47-46(38,45-19-14(7-33)44-23(20(19)39-3)31-5-4-16(35)30-24(31)36)41-8-15-13(34)6-17(43-15)32-10-29-18-21(26)27-9-28-22(18)32/h4-5,9-10,12-15,17,19-20,23,33-34H,6-8,11H2,1-3H3,(H2,26,27,28)(H,30,35,36)/t13-,14+,15+,17+,19+,20+,23+,46?/m0/s1 |
| InChIKey | CJCYTUJOSMYXLE-JDLSZIHUSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inarigivir soproxil (CHEBI:749132) has role anti-HBV agent (CHEBI:64951) |
| inarigivir soproxil (CHEBI:749132) is a purines (CHEBI:26401) |
| INNs | Source |
|---|---|
| inarigivir soproxil | WHO MedNet |
| inarigivir soproxilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| SB-44 | ChEMBL |
| SB 9200 | ChEMBL |
| SB-9200 | ChEMBL |
| Citations |
|---|