EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17NO5 |
| Net Charge | 0 |
| Average Mass | 351.358 |
| Monoisotopic Mass | 351.11067 |
| SMILES | C#CCOc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C20H17NO5/c1-3-12-26-17-10-8-14(13-18(17)25-2)9-11-19(22)21-16-7-5-4-6-15(16)20(23)24/h1,4-11,13H,12H2,2H3,(H,21,22)(H,23,24)/b11-9+ |
| InChIKey | UIWZIDIJCUEOMT-PKNBQFBNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asengeprast (CHEBI:749124) has role anti-inflammatory agent (CHEBI:67079) |
| asengeprast (CHEBI:749124) is a amidobenzoic acid (CHEBI:48470) |
| INN | Source |
|---|---|
| asengeprast | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ft011 | ChEMBL |
| FT-011 | ChEMBL |
| FT-11 | ChEMBL |
| Shp-627 | ChEMBL |
| Citations |
|---|