EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31NO |
| Net Charge | 0 |
| Average Mass | 337.507 |
| Monoisotopic Mass | 337.24056 |
| SMILES | [H][C@@]12[C@@H](C)CC(=C)C[C@@]13CCN(CC1CCC1)[C@]2([H])Cc1ccc(O)cc13 |
| InChI | InChI=1S/C23H31NO/c1-15-10-16(2)22-21-11-18-6-7-19(25)12-20(18)23(22,13-15)8-9-24(21)14-17-4-3-5-17/h6-7,12,16-17,21-22,25H,1,3-5,8-11,13-14H2,2H3/t16-,21+,22-,23+/m0/s1 |
| InChIKey | AZJPPZHRNFQRRE-AZIXLERZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xorphanol (CHEBI:749123) is a morphinane alkaloid (CHEBI:25418) |
| INNs | Source |
|---|---|
| xorfanol | WHO MedNet |
| xorphanol | WHO MedNet |
| Synonym | Source |
|---|---|
| Tr 5379 | ChEMBL |
| Citations |
|---|