EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749119 - talotrexin
| Formula | C27H27N9O6 |
| Net Charge | 0 |
| Average Mass | 573.570 |
| Monoisotopic Mass | 573.20843 |
| SMILES | Nc1nc(N)c2nc(CNc3ccc(C(=O)N[C@@H](CCCNC(=O)c4ccccc4C(=O)O)C(=O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C27H27N9O6/c28-21-20-22(36-27(29)35-21)32-13-16(33-20)12-31-15-9-7-14(8-10-15)23(37)34-19(26(41)42)6-3-11-30-24(38)17-4-1-2-5-18(17)25(39)40/h1-2,4-5,7-10,13,19,31H,3,6,11-12H2,(H,30,38)(H,34,37)(H,39,40)(H,41,42)(H4,28,29,32,35,36)/t19-/m0/s1 |
| InChIKey | NYQPLPNEESYGNO-IBGZPJMESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talotrexin (CHEBI:749119) is a N-acylglycine (CHEBI:16180) |
| INNs | Source |
|---|---|
| talotrexin | WHO MedNet |
| talotrexina | WHO MedNet |
| talotrexine | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-623017 | ChEMBL |
| NSC-633713 | ChEMBL |
| Citations |
|---|