EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749117 - indigo
| Formula | C16H10N2O2 |
| Net Charge | 0 |
| Average Mass | 262.268 |
| Monoisotopic Mass | 262.07423 |
| SMILES | O=C1/C(=C2\Nc3ccccc3C2=O)Nc2ccccc21 |
| InChI | InChI=1S/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17-18H/b14-13+ |
| InChIKey | COHYTHOBJLSHDF-BUHFOSPRSA-N |
| Roles Classification |
|---|
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indigo (CHEBI:749117) has role antineoplastic agent (CHEBI:35610) |
| indigo (CHEBI:749117) has role antipsoriatic (CHEBI:50748) |
| indigo (CHEBI:749117) has role dermatologic drug (CHEBI:50177) |
| indigo (CHEBI:749117) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| Ao201 | ChEMBL |
| Ci 73000 | ChEMBL |
| C.I.73000 | ChEMBL |
| Indigo | ChEMBL |
| Indigo blue | ChEMBL |
| Indigofera orthocarpa whole | ChEMBL |
| Citations |
|---|