EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749114 - derenofylline
| Formula | C18H20N4O |
| Net Charge | 0 |
| Average Mass | 308.385 |
| Monoisotopic Mass | 308.16371 |
| SMILES | OC1CCC(Nc2nc(-c3ccccc3)nc3nccc23)CC1 |
| InChI | InChI=1S/C18H20N4O/c23-14-8-6-13(7-9-14)20-18-15-10-11-19-17(15)21-16(22-18)12-4-2-1-3-5-12/h1-5,10-11,13-14,23H,6-9H2,(H2,19,20,21,22) |
| InChIKey | RBZNJGHIKXAKQE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| derenofylline (CHEBI:749114) has role cardiovascular drug (CHEBI:35554) |
| derenofylline (CHEBI:749114) is a pyrrolopyrimidine (CHEBI:38670) |
| INNs | Source |
|---|---|
| derenofilina | WHO MedNet |
| derenofylline | WHO MedNet |
| Synonyms | Source |
|---|---|
| SLV-320 | ChEMBL |
| SLV320 | ChEMBL |
| Citations |
|---|