EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H21N3O4 |
| Net Charge | 0 |
| Average Mass | 439.471 |
| Monoisotopic Mass | 439.15321 |
| SMILES | [H][C@]12C[C@](O)(CO)[C@](C)(O1)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 |
| InChI | InChI=1S/C26H21N3O4/c1-25-26(32,12-30)10-18(33-25)28-16-8-4-2-6-13(16)20-21-15(11-27-24(21)31)19-14-7-3-5-9-17(14)29(25)23(19)22(20)28/h2-9,18,30,32H,10-12H2,1H3,(H,27,31)/t18-,25+,26+/m1/s1 |
| InChIKey | UIARLYUEJFELEN-LROUJFHJSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipsoriatic A drug used to treat psoriasis. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lestaurtinib (CHEBI:749110) has role antifibrotic agent (CHEBI:233423) |
| lestaurtinib (CHEBI:749110) has role antineoplastic agent (CHEBI:35610) |
| lestaurtinib (CHEBI:749110) has role antipsoriatic (CHEBI:50748) |
| lestaurtinib (CHEBI:749110) is a indolocarbazole (CHEBI:51915) |
| INN | Source |
|---|---|
| lestaurtinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| A-154475 | ChEMBL |
| A-154475.0 | ChEMBL |
| CEP-701 | ChEMBL |
| KT-555 | ChEMBL |
| KT-5555 | ChEMBL |
| KT5555 | ChEMBL |
| Citations |
|---|